| SpectraBase Spectrum ID |
CuEowVB43Xt |
| Name |
2,4,6-Tris(3,4-difluorophenyl)boroxin |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
T2430 |
| Lot Number |
LWH6A-TP |
| Accessory |
DuraSample IR #145404C7 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
16 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.270473 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Rotations |
32 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-1350 |
| Backward Peak Location |
7370 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
1456935-98-0 |
| Color Properties |
White - Very pale yellow |
| Container ID |
C-010379 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
1 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C18H9B3F6O3 |
| Frequency of First Point |
3998.31 cm⁻¹ |
| Frequency of Last Point |
339.461 cm⁻¹ |
| High Folding Limit |
15800.4 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C18H9B3F6O3/c22-13-4-1-10(7-16(13)25)19-28-20(11-2-5-14(23)17(26)8-11)30-21(29-19)12-3-6-15(24)18(27)9-12/h1-9H |
| InChIKey |
KIRMDENYWDSJJI-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.4 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Measurement Channel |
Sample Compartment |
| Molecular Weight |
419.687 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
3795 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-1379 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
7365 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
8 |
| Preamplifier Gain |
3 |
| Preamplifier Gain Background |
0 |
| Purity |
>98.0% |
| Relative Humidity Interferometer |
20 % |
| Resolution |
4 |
| SKU |
T2430-5G |
| SMILES |
c1(B2OB(OB(O2)c2cc(c(cc2)F)F)c2ccc(c(c2)F)F)cc(c(cc1)F)F |
| Sample Comments |
Sample ground at metal edge of ATR |
| Sample Rotations |
32 |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
27.301 s |
| Scanner Temperature |
29.1 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Signal Gain, Sample |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
3,4-Difluorophenylboronic anhydride; Tris(3,4-difluorophenyl)cycloboroxane |
| Technique |
ATR-Neat |
| Zero Filling Factor |
4 |
