| SpectraBase Spectrum ID |
BHU5m3NkfmI |
| Name |
(2R,5S)-2-((tert-Butyldimethylsilyl)oxy)-5-isopropyl-2-methylcyclohexan-1-one |
| Appearance |
Colorless oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H32O2Si |
| InChI |
InChI=1S/C16H32O2Si/c1-12(2)13-9-10-16(6,14(17)11-13)18-19(7,8)15(3,4)5/h12-13H,9-11H2,1-8H3/t13-,16+/m0/s1 |
| InChIKey |
DJJMMMVENAISGY-XJKSGUPXSA-N |
| Instrument Name |
Agilent 6890 and Finnigan MAT 95 XL |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3762/bjoc.14.222 |
| Molecular Weight |
284.515 g/mol |
| Optical Rotation |
[a]D24 = -56.8 (c = 2.4, CHCl3) |
| Reported Formula |
C16H32O2Si |
| SMILES |
C1[C@@](C(C[C@](C1)(C(C)C)[H])=O)(C)O[Si](C(C)(C)C)(C)C |
| SPLASH |
splash10-004i-7590000000-21a098c629d45b13a903 |
| Source of Spectrum |
BJO-14-SM9-21 |
| Thin-Layer Chromatography |
Rf = 0.44 (petroleum ether/EtOAc, 20:1) |
| Wiley ID |
1845723 |
