| SpectraBase Spectrum ID |
8OsX8Gr4tWS |
| Name |
N,N'-Dimethyl-N,N'-diphenyl-methandiamine |
| Appearance |
Viscous, colorless oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C15H18N2 |
| InChI |
InChI=1S/C15H18N2/c1-16(14-9-5-3-6-10-14)13-17(2)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3 |
| InChIKey |
YBGCFBFAENBIIZ-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
226.323 g/mol |
| SMILES |
CN(CN(c1ccccc1)C)c1ccccc1 |
| SPLASH |
splash10-00di-2900000000-17ca59ed4874c525ed0b |
| Source of Spectrum |
ARK-2005-163-13 |
| Thin-Layer Chromatography |
Rf = 0.26 (diethyl ether/petroleum ether, 1:6) |
| Wiley ID |
1871026 |
