| SpectraBase Spectrum ID |
4Z7g1X5G40 |
| Name |
Methyl 1H-benzo[g]indole-2-carboxylate |
| Appearance |
Brown solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H11NO2 |
| InChI |
InChI=1S/C14H11NO2/c1-17-14(16)12-8-10-7-6-9-4-2-3-5-11(9)13(10)15-12/h2-8,15H,1H3 |
| InChIKey |
NFLXKEHVYVOZAZ-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
225.247 g/mol |
| Reported Formula |
C14H11NO2 |
| SMILES |
[nH]1c2c(cc1C(OC)=O)ccc1c2cccc1 |
| SPLASH |
splash10-00mo-1940000000-0bd375d0329fdd9b0447 |
| Source of Spectrum |
ARK-2014-41-1f |
| Thin-Layer Chromatography |
Rf = 0.59 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843225 |
![Methyl 1H-benzo[g]indole-2-carboxylate](/api/spectrum/4Z7g1X5G40/structure.png?h=300&w=458 "Methyl 1H-benzo[g]indole-2-carboxylate")
